Difference between revisions of "PWY-7291"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7291 PWY-7291] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7291 PWY-7291] ==
* smiles:
+
* taxonomic range:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
+
 
* common name:
 
* common name:
** 18-hydroxyoleoyl-CoA
+
** oleate β-oxidation (isomerase-dependent, yeast)
* molecular weight:
+
** 1043.952   
+
 
* Synonym(s):
 
* Synonym(s):
** (9Z)-18-hydroxyoctadec-9-enoyl-CoA
 
** ω-hydroxyoleoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16117]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-14576]]
* [[RXN-16402]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-22_002920]]
 +
*** [[Ec-26_004320]]
 +
*** [[Ec-08_006390]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7931]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14575 RXN-14575]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14577 RXN-14577]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566]
+
{{#set: common name=oleate β-oxidation (isomerase-dependent, yeast)}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044]
+
{{#set: total reaction=4}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: completion rate=50.0}}
{{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}}
+
{{#set: common name=18-hydroxyoleoyl-CoA}}
+
{{#set: molecular weight=1043.952    }}
+
{{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|ω-hydroxyoleoyl-CoA}}
+
{{#set: consumed by=RXN-16117}}
+
{{#set: produced by=RXN-16402}}
+

Latest revision as of 19:29, 21 March 2018

Pathway PWY-7291

  • taxonomic range:
  • common name:
    • oleate β-oxidation (isomerase-dependent, yeast)
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links