Difference between revisions of "CPD-13717"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_005100 == * left end position: ** 4611557 * transcription direction: ** NEGATIVE * right end position: ** 4627020 * centisome position: ** 71.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N |
| − | * | + | * common name: |
| − | ** | + | ** L-selenocystathionine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 269.159 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12729]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-15137]] | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: reaction associated= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699] |
| + | * HMDB : HMDB06343 | ||
| + | {{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}} | ||
| + | {{#set: common name=L-selenocystathionine}} | ||
| + | {{#set: molecular weight=269.159 }} | ||
| + | {{#set: consumed by=RXN-12729}} | ||
| + | {{#set: reversible reaction associated=RXN-15137}} | ||
Latest revision as of 20:30, 21 March 2018
Contents
Metabolite CPD-13717
- smiles:
- C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
- inchi key:
- InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
- common name:
- L-selenocystathionine
- molecular weight:
- 269.159
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
