Difference between revisions of "CPD-15016"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=H2CO3 H2CO3] == * smiles: ** C(O)(=O)O * inchi key: ** InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-N * c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == |
* smiles: | * smiles: | ||
| − | ** C(O)(=O)O | + | ** C(C(=O)C([O-])=O)C(C([O-])=O)O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L |
* common name: | * common name: | ||
| − | ** | + | ** (4S)-4-hydroxy-2-oxoglutarate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 160.083 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-4-hydroxy-2-oxoglutarate |
| + | ** L-4-hydroxy-2-ketoglutarate | ||
| + | ** (S)-2-hydroxy-4-oxopentanedioate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-13990]] |
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685] |
| − | {{#set: smiles=C(O)(=O)O}} | + | * METABOLIGHTS : MTBLC71685 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=160.083 }} |
| − | {{#set: reversible reaction associated= | + | {{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}} |
| + | {{#set: reversible reaction associated=RXN-13990}} | ||
Latest revision as of 19:30, 21 March 2018
Contents
Metabolite CPD-15016
- smiles:
- C(C(=O)C([O-])=O)C(C([O-])=O)O
- inchi key:
- InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
- common name:
- (4S)-4-hydroxy-2-oxoglutarate
- molecular weight:
- 160.083
- Synonym(s):
- L-4-hydroxy-2-oxoglutarate
- L-4-hydroxy-2-ketoglutarate
- (S)-2-hydroxy-4-oxopentanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(=O)C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.
