Difference between revisions of "Ec-16 002160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...")
(Created page with "Category:Gene == Gene Ec-16_002160 == * left end position: ** 2359865 * transcription direction: ** POSITIVE * right end position: ** 2366190 * centisome position: ** 44.2...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] ==
+
== Gene Ec-16_002160 ==
−
* smiles:
+
* left end position:
−
** C([O-])(=O)C(O)=CC1(C=CC=CC=1)
+
** 2359865
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DEDGUGJNLNLJSR-VURMDHGXSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** enol-phenylpyruvate
+
** 2366190
−
* molecular weight:
+
* centisome position:
−
** 163.152    
+
** 44.211655    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0047_0048
 +
** Esi0047_0048
 +
** Taz1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.3.1.23-RXN]]
−
* [[PHENYLPYRUVATE-TAUTOMERASE-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15036]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15066]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16041]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16042]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16043]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16044]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16045]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16150]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16151]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16152]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16157]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16158]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17688]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-9670]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7053]]
 +
* [[PWY-5353]]
 +
* [[PWY-6433]]
 +
* [[PWY-5368]]
 +
* [[PWY-5995]]
 +
* [[PWY-7470]]
 +
* [[PWY-7416]]
 +
* [[PWY-7409]]
 +
* [[PWY-6803]]
 +
* [[PWY-6958]]
 +
* [[PWY-7618]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: left end position=2359865}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=280708 280708]
+
{{#set: transcription direction=POSITIVE}}
−
* CAS : 5801-57-0
+
{{#set: right end position=2366190}}
−
* PUBCHEM:
+
{{#set: centisome position=44.211655    }}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54705603 54705603]
+
{{#set: common name=Esi_0047_0048|Esi0047_0048|Taz1}}
−
* HMDB : HMDB12225
+
{{#set: reaction associated=2.3.1.23-RXN|RXN-15036|RXN-15066|RXN-16041|RXN-16042|RXN-16043|RXN-16044|RXN-16045|RXN-16150|RXN-16151|RXN-16152|RXN-16157|RXN-16158|RXN-17688|RXN-9670}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7053|PWY-5353|PWY-6433|PWY-5368|PWY-5995|PWY-7470|PWY-7416|PWY-7409|PWY-6803|PWY-6958|PWY-7618}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02763 C02763]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.20058468.html 20058468]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32815 32815]
+
−
{{#set: smiles=C([O-])(=O)C(O)=CC1(C=CC=CC=1)}}
+
−
{{#set: inchi key=InChIKey=DEDGUGJNLNLJSR-VURMDHGXSA-M}}
+
−
{{#set: common name=enol-phenylpyruvate}}
+
−
{{#set: molecular weight=163.152    }}
+
−
{{#set: produced by=PHENYLPYRUVATE-TAUTOMERASE-RXN}}
+

Latest revision as of 19:30, 21 March 2018

Gene Ec-16_002160

  • left end position:
    • 2359865
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2366190
  • centisome position:
    • 44.211655
  • Synonym(s):
    • Esi_0047_0048
    • Esi0047_0048
    • Taz1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_002160&oldid=27370"