Difference between revisions of "Ec-15 003720"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * inchi key: ** InChIKey=KRKNYBC...") |
(Created page with "Category:Gene == Gene Ec-15_003720 == * left end position: ** 4011642 * transcription direction: ** POSITIVE * right end position: ** 4017444 * centisome position: ** 74.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_003720 == |
− | * | + | * left end position: |
− | ** | + | ** 4011642 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4017444 |
− | * | + | * centisome position: |
− | ** | + | ** 74.313705 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0294_0036 |
− | ** | + | ** Esi0294_0036 |
− | ** | + | ** ACV |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * | + | == Pathways associated == |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4011642}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4017444}} | |
− | + | {{#set: centisome position=74.313705 }} | |
− | + | {{#set: common name=Esi_0294_0036|Esi0294_0036|ACV}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:31, 21 March 2018
Gene Ec-15_003720
- left end position:
- 4011642
- transcription direction:
- POSITIVE
- right end position:
- 4017444
- centisome position:
- 74.313705
- Synonym(s):
- Esi_0294_0036
- Esi0294_0036
- ACV
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome