Difference between revisions of "Saturated-Fatty-Acyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-Fatty-Acyl-ACPs Saturated-Fatty-Acyl-ACPs] == * common name: ** a 2,3,4-saturated fat...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-Fatty-Acyl-ACPs Saturated-Fatty-Acyl-ACPs] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** 71-hydroxychlorophyllide a
+
** a 2,3,4-saturated fatty acyl-[acp]
* molecular weight:
+
** 628.966   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-hydroxychlorophyllide a (misleading)
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7677]]
+
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN0-5514]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7676]]
+
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 2,3,4-saturated fatty acyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
+
{{#set: consumed by=3-OXOACYL-ACP-SYNTH-RXN|RXN0-5514}}
* LIGAND-CPD:
+
{{#set: produced by=ENOYL-ACP-REDUCT-NADH-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=71-hydroxychlorophyllide a}}
+
{{#set: molecular weight=628.966    }}
+
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
+
{{#set: consumed by=RXN-7677}}
+
{{#set: produced by=RXN-7676}}
+

Latest revision as of 19:31, 21 March 2018

Metabolite Saturated-Fatty-Acyl-ACPs

  • common name:
    • a 2,3,4-saturated fatty acyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 2,3,4-saturated fatty acyl-[acp" cannot be used as a page name in this wiki.