Difference between revisions of "PWY-6147"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] == * smiles: ** CC(OCC([N+])C(=O)[O-])=O * inchi key: ** InChIKey=VZ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6147 PWY-6147] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6147 PWY-6147] ==
−
* smiles:
+
* taxonomic range:
−
** CC(OCC([N+])C(=O)[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
** InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** O-acetyl-L-serine
+
** 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I
−
* molecular weight:
+
−
** 147.13   
+
 
* Synonym(s):
 
* Synonym(s):
−
** O3-acetyl-L-serine
 
−
** acetylserine
 
−
** O-acetylserine
 
−
** (2S)-3-acetyloxy-2-aminopropanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-12726]]
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
−
* [[SERINE-O-ACETTRAN-RXN]]
+
** 27 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-18_000740]]
−
* [[ACSERLY-RXN]]
+
*** [[Ec-12_006470]]
−
* [[SULFOCYS-RXN]]
+
*** [[Ec-00_002040]]
 +
*** [[Ec-06_010060]]
 +
*** [[Ec-04_000920]]
 +
*** [[Ec-15_003300]]
 +
*** [[Ec-06_009970]]
 +
*** [[Ec-01_000090]]
 +
*** [[Ec-05_006830]]
 +
*** [[Ec-12_001230]]
 +
*** [[Ec-10_002470]]
 +
*** [[Ec-15_000350]]
 +
*** [[Ec-06_007890]]
 +
*** [[Ec-10_002170]]
 +
*** [[Ec-09_003740]]
 +
*** [[Ec-19_001450]]
 +
*** [[Ec-24_003120]]
 +
*** [[Ec-14_006830]]
 +
*** [[Ec-19_001540]]
 +
*** [[Ec-15_000660]]
 +
*** [[Ec-19_001310]]
 +
*** [[Ec-09_003200]]
 +
*** [[Ec-01_009100]]
 +
*** [[Ec-15_001630]]
 +
*** [[Ec-19_003700]]
 +
*** [[Ec-14_006970]]
 +
*** [[Ec-22_000120]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[GTP-CYCLOHYDRO-I-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_007000]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[H2NEOPTERINALDOL-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 +
** 27 associated gene(s):
 +
*** [[Ec-14_006830]]
 +
*** [[Ec-09_003740]]
 +
*** [[Ec-01_009100]]
 +
*** [[Ec-04_000920]]
 +
*** [[Ec-06_007890]]
 +
*** [[Ec-00_002040]]
 +
*** [[Ec-12_006470]]
 +
*** [[Ec-01_000090]]
 +
*** [[Ec-09_003200]]
 +
*** [[Ec-06_010060]]
 +
*** [[Ec-10_002470]]
 +
*** [[Ec-05_006830]]
 +
*** [[Ec-14_006970]]
 +
*** [[Ec-12_001230]]
 +
*** [[Ec-15_000660]]
 +
*** [[Ec-15_001630]]
 +
*** [[Ec-18_000740]]
 +
*** [[Ec-24_003120]]
 +
*** [[Ec-15_000350]]
 +
*** [[Ec-19_001310]]
 +
*** [[Ec-10_002170]]
 +
*** [[Ec-19_001540]]
 +
*** [[Ec-19_003700]]
 +
*** [[Ec-19_001450]]
 +
*** [[Ec-15_003300]]
 +
*** [[Ec-06_009970]]
 +
*** [[Ec-22_000120]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_000230]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 66638-22-0
+
* ECOCYC:
−
* METABOLIGHTS : MTBLC17981
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6147 PWY-6147]
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971051 6971051]
+
{{#set: taxonomic range=TAX-33090}}
−
* HMDB : HMDB03011
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=6-hydroxymethyl-dihydropterin diphosphate biosynthesis I}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00979 C00979]
+
{{#set: reaction found=5}}
−
* CHEBI:
+
{{#set: total reaction=5}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58340 58340]
+
{{#set: completion rate=100.0}}
−
* BIGG : acser
+
−
{{#set: smiles=CC(OCC([N+])C(=O)[O-])=O}}
+
−
{{#set: inchi key=InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N}}
+
−
{{#set: common name=O-acetyl-L-serine}}
+
−
{{#set: molecular weight=147.13    }}
+
−
{{#set: common name=O3-acetyl-L-serine|acetylserine|O-acetylserine|(2S)-3-acetyloxy-2-aminopropanoate}}
+
−
{{#set: consumed by=RXN-12726}}
+
−
{{#set: produced by=SERINE-O-ACETTRAN-RXN}}
+
−
{{#set: reversible reaction associated=ACSERLY-RXN|SULFOCYS-RXN}}
+

Latest revision as of 19:31, 21 March 2018

Pathway PWY-6147

  • taxonomic range:
  • common name:
    • 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6147&oldid=27513"