Difference between revisions of "RXN0-2142"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2142 RXN0-2142] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2142 RXN0-2142] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** NAD(P)-binding domain |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[b-Keto-cis-D5-dodecenoyl-ACPs]][c] '''=>''' 1 [[b-Hydroxy-cis-D5-dodecenoyl-ACPs]][c] '''+''' 1 [[NADP]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a (5Z)-3-oxo-dodec-5-enoyl-[acp][c] '''=>''' 1 a (3R,5Z)-3-hydroxy-dodec-5-enoyl-[acp][c] '''+''' 1 NADP+[c] | |
| − | + | ||
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Ec-01_007100]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | == | + | *** Assignment: EC-NUMBER |
| + | == Pathways == | ||
| + | * [[PWY0-862]], (5Z)-dodec-5-enoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862] | ||
| + | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=NAD(P)-binding domain}} | |
| − | + | {{#set: ec number=EC-1.1.1.100}} | |
| − | + | {{#set: gene associated=Ec-01_007100}} | |
| − | + | {{#set: in pathway=PWY0-862}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:32, 21 March 2018
Contents
Reaction RXN0-2142
- direction:
- LEFT-TO-RIGHT
- common name:
- NAD(P)-binding domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 PROTON[c] + 1 b-Keto-cis-D5-dodecenoyl-ACPs[c] => 1 b-Hydroxy-cis-D5-dodecenoyl-ACPs[c] + 1 NADP[c]
- With common name(s):
- 1 NADPH[c] + 1 H+[c] + 1 a (5Z)-3-oxo-dodec-5-enoyl-[acp][c] => 1 a (3R,5Z)-3-hydroxy-dodec-5-enoyl-[acp][c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-01_007100
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY0-862, (5Z)-dodec-5-enoate biosynthesis: PWY0-862
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
