Difference between revisions of "VALDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TA...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] | ||
* common name: | * common name: | ||
− | ** | + | ** L-valine degradation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''8''' reactions found over '''8''' reactions in the full pathway | |
− | + | * [[1.2.1.25-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
+ | *** [[Ec-06_009010]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[2.6.1.22-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-14_006530]] | ||
+ | *** [[Ec-11_000140]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-12_005560]] | ||
+ | *** [[Ec-12_005530]] | ||
+ | *** [[Ec-12_005520]] | ||
+ | *** [[Ec-20_001390]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[MEPROPCOA-FAD-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[METHYLACYLYLCOA-HYDROXY-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Ec-16_001250]] | ||
+ | *** [[Ec-14_006530]] | ||
+ | *** [[Ec-17_000320]] | ||
+ | *** [[Ec-06_001380]] | ||
+ | *** [[Ec-16_003560]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-11213]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-10_003810]] | ||
+ | *** [[Ec-06_003440]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY] |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-201174}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=L-valine degradation I}} | |
− | + | {{#set: reaction found=8}} | |
− | {{#set: | + | {{#set: total reaction=8}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Pathway VALDEG-PWY
- taxonomic range:
- common name:
- L-valine degradation I
- Synonym(s):
Reaction(s) found
8 reactions found over 8 reactions in the full pathway
- 1.2.1.25-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- 2.6.1.22-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- 3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- 3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- BRANCHED-CHAINAMINOTRANSFERVAL-RXN
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- MEPROPCOA-FAD-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- METHYLACYLYLCOA-HYDROXY-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-11213
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: