Difference between revisions of "MPBQ"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C * inchi key: ** In...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N |
* common name: | * common name: | ||
− | ** | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 402.659 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-2542]] | ||
+ | * [[RXN-2561]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-2541]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920] | ||
+ | * METABOLIGHTS : MTBLC75920 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135] |
− | {{#set: smiles=C( | + | * HMDB : HMDB38959 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}} |
− | {{#set: | + | {{#set: molecular weight=402.659 }} |
− | {{#set: | + | {{#set: consumed by=RXN-2542|RXN-2561}} |
+ | {{#set: produced by=RXN-2541}} |
Latest revision as of 20:32, 21 March 2018
Contents
Metabolite MPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C=C(C)C=1O)O))C)C
- inchi key:
- InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N
- common name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- molecular weight:
- 402.659
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links