Difference between revisions of "CPD-4702"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_005250 == * left end position: ** 4819202 * transcription direction: ** NEGATIVE * right end position: ** 4837545 * centisome position: ** 73.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M |
| − | * | + | * common name: |
| − | ** | + | ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 427.646 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN66-318]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076] |
| − | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}} |
| − | {{#set: | + | {{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}} |
| − | {{#set: | + | {{#set: molecular weight=427.646 }} |
| + | {{#set: consumed by=RXN66-318}} | ||
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-4702
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
- common name:
- 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
- molecular weight:
- 427.646
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
