Difference between revisions of "RXN-8036"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * smiles: ** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8036 RXN-8036] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-glucosidase, family GH1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8036 RXN-8036] ==
−
* smiles:
+
* direction:
−
** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J
+
 
* common name:
 
* common name:
−
** 3-methylcrotonyl-CoA
+
** Beta-glucosidase, family GH1
−
* molecular weight:
+
** Beta-glucosidase, family GH3
−
** 845.604   
+
** Beta-glucosidase, family GH30
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.2.1.21 EC-3.2.1.21]
 
* Synonym(s):
 
* Synonym(s):
−
** β-methylcrotonoyl-CoA
 
−
** 3-methylbut-2-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-7417]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[CPD-7418]][c]
−
* [[RXN0-2301]]
+
* With common name(s):
−
* [[RXN-11921]]
+
** 1 H2O[c] '''+''' 1 cis-coumarinic acid-β-D-glucoside[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 coumarinate[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[RXN-14264]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-07_001850]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-07_005240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-20_004800]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-26_002410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-04_002190]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5176]], coumarin biosynthesis (via 2-coumarate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5176 PWY-5176]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C03069 C03069]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31223 31223]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57344 57344]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04998 R04998]
−
* METABOLIGHTS : MTBLC57344
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Beta-glucosidase, family GH1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266575 45266575]
+
{{#set: common name=Beta-glucosidase, family GH3}}
−
* HMDB : HMDB01493
+
{{#set: common name=Beta-glucosidase, family GH30}}
−
{{#set: smiles=CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
{{#set: ec number=EC-3.2.1.21}}
−
{{#set: inchi key=InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J}}
+
{{#set: gene associated=Ec-07_001850|Ec-07_005240|Ec-20_004800|Ec-26_002410|Ec-04_002190}}
−
{{#set: common name=3-methylcrotonyl-CoA}}
+
{{#set: in pathway=PWY-5176}}
−
{{#set: molecular weight=845.604    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=β-methylcrotonoyl-CoA|3-methylbut-2-enoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: consumed by=METHYLCROTONYL-COA-CARBOXYLASE-RXN}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: produced by=RXN0-2301|RXN-11921}}
+
−
{{#set: reversible reaction associated=RXN-14264}}
+

Latest revision as of 19:34, 21 March 2018

Reaction RXN-8036

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Beta-glucosidase, family GH1
    • Beta-glucosidase, family GH3
    • Beta-glucosidase, family GH30
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 cis-coumarinic acid-β-D-glucoside[c] => 1 D-glucopyranose[c] + 1 coumarinate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5176, coumarin biosynthesis (via 2-coumarate): PWY-5176
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-8036&oldid=27830"