Difference between revisions of "RXN-9540"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * inchi key: ** InChIKey=ZQP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9540 RXN-9540] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-palmitoyl-[acyl-carrier...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9540 RXN-9540] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M
+
 
* common name:
 
* common name:
−
** oleate
+
** 3-oxo-palmitoyl-[acyl-carrier protein] reductase
−
* molecular weight:
+
** NAD(P)-binding domain
−
** 281.457   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
−
** oleic acid
 
−
** (9Z)-octadec-9-enoate
 
−
** (9Z)-octadecenoate
 
−
** (9Z)-octadecenoic acid
 
−
** (9Z)-octadec-9-enoic acid
 
−
** (Z)-octadec-9-enoic acid
 
−
** 18:1 n-9
 
−
** 18:1Δ9cis
 
−
** C18:1 n-9
 
−
** cis-9-octadecenoic acid
 
−
** cis-Δ9-octadecenoic acid
 
−
** cis-oleic acid
 
−
** octadec-9-enoic acid
 
−
** octadecenoate (n-C18:1)
 
−
** 9-octadecenoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9644]]
+
* With identifiers:
−
* [[RXN0-7239]]
+
** 1 [[PROTON]][c] '''+''' 1 [[3-oxo-palmitoyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[R-3-Hydroxypalmitoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-15067]]
+
** 1 H+[c] '''+''' 1 a 3-oxo-palmitoyl-[acp][c] '''+''' 1 NADPH[c] '''=>''' 1 a (3R)-3-hydroxypalmitoyl-[acp][c] '''+''' 1 NADP+[c]
−
* [[RXN-15035]]
+
 
−
* [[RXN-15068]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_007100]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''28''' reactions found over '''31''' reactions in the full pathway
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''20''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 112-80-1
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 1451011
+
{{#set: common name=3-oxo-palmitoyl-[acyl-carrier protein] reductase}}
−
* PUBCHEM:
+
{{#set: common name=NAD(P)-binding domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460221 5460221]
+
{{#set: ec number=EC-2.3.1.86}}
−
* HMDB : HMDB00207
+
{{#set: ec number=EC-2.3.1.85}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.1.1.100}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00712 C00712]
+
{{#set: gene associated=Ec-01_007100}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-5971|PWY-5994}}
−
** [http://www.chemspider.com/Chemical-Structure.4573837.html 4573837]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30823 30823]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC30823
+
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M}}
+
−
{{#set: common name=oleate}}
+
−
{{#set: molecular weight=281.457    }}
+
−
{{#set: common name=oleic acid|(9Z)-octadec-9-enoate|(9Z)-octadecenoate|(9Z)-octadecenoic acid|(9Z)-octadec-9-enoic acid|(Z)-octadec-9-enoic acid|18:1 n-9|18:1Δ9cis|C18:1 n-9|cis-9-octadecenoic acid|cis-Δ9-octadecenoic acid|cis-oleic acid|octadec-9-enoic acid|octadecenoate (n-C18:1)|9-octadecenoic acid}}
+
−
{{#set: consumed by=RXN-9644|RXN0-7239}}
+
−
{{#set: produced by=RXN-15067|RXN-15035|RXN-15068}}
+

Latest revision as of 20:34, 21 March 2018

Reaction RXN-9540

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 28 reactions found over 31 reactions in the full pathway
  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 20 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-palmitoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9540&oldid=27847"