Difference between revisions of "PWY-3861"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3861 PWY-3861] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-5...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3861 PWY-3861] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-58023] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** mannitol degradation II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[MANNPISOM-RXN]] |
| − | == Reaction(s) | + | ** 4 associated gene(s): |
| + | *** [[Ec-20_000830]] | ||
| + | *** [[Ec-28_000080]] | ||
| + | *** [[Ec-28_000050]] | ||
| + | *** [[Ec-27_005440]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXN-14500]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.255-RXN 1.1.1.255-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=MANNKIN-RXN MANNKIN-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-58023}} | |
| − | + | {{#set: common name=mannitol degradation II}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:34, 21 March 2018
Pathway PWY-3861
- taxonomic range:
- common name:
- mannitol degradation II
- Synonym(s):
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- MANNPISOM-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-14500
- 0 associated gene:
- 1 reconstruction source(s) associated:
