Difference between revisions of "RXN-22"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] == * direction: ** LEFT-TO-RIGHT * common name: ** Argininosuccinate lyase * ec numb...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] ==
* smiles:
+
* direction:
** C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N
+
 
* common name:
 
* common name:
** nigerose
+
** Argininosuccinate lyase
* molecular weight:
+
* ec number:
** 342.299   
+
** [http://enzyme.expasy.org/EC/4.3.2.1 EC-4.3.2.1]
 
* Synonym(s):
 
* Synonym(s):
** α-1,3-glucose disaccharide
 
** sakebiose
 
** 3-O-α-D-glucopyranosyl-D-glucopyranose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN0-5395]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CANAVANINOSUCCINATE]][c] '''=>''' 1 [[FUM]][c] '''+''' 1 [[CANAVANINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 canavaninosuccinate[c] '''=>''' 1 fumarate[c] '''+''' 1 L-canavanine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_005890]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5]], canavanine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439512 439512]
+
{{#set: common name=Argininosuccinate lyase}}
* CHEBI:
+
{{#set: ec number=EC-4.3.2.1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7570 7570]
+
{{#set: gene associated=Ec-12_005890}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5}}
** [http://www.genome.jp/dbget-bin/www_bget?C01518 C01518]
+
{{#set: reconstruction category=annotation}}
* HMDB : HMDB29882
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N}}
+
{{#set: common name=nigerose}}
+
{{#set: molecular weight=342.299    }}
+
{{#set: common name=α-1,3-glucose disaccharide|sakebiose|3-O-α-D-glucopyranosyl-D-glucopyranose}}
+
{{#set: consumed by=RXN0-5395}}
+

Latest revision as of 19:34, 21 March 2018

Reaction RXN-22

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Argininosuccinate lyase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5, canavanine biosynthesis: PWY-5
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links