Difference between revisions of "Ec-07 001510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-07_001510 == * left end position: ** 1684476 * transcription direction: ** POSITIVE * right end position: ** 1696123 * centisome position: ** 21.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_001510 == |
− | * | + | * left end position: |
− | ** | + | ** 1684476 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1696123 |
− | * | + | * centisome position: |
− | ** | + | ** 21.81277 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0413_0014 |
+ | ** Esi0413_0014 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1684476}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1696123}} | |
− | + | {{#set: centisome position=21.81277 }} | |
− | + | {{#set: common name=Esi_0413_0014|Esi0413_0014}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:34, 21 March 2018
Gene Ec-07_001510
- left end position:
- 1684476
- transcription direction:
- POSITIVE
- right end position:
- 1696123
- centisome position:
- 21.81277
- Synonym(s):
- Esi_0413_0014
- Esi0413_0014
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome