Difference between revisions of "6-Dimethylallyladenosine37-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6-Dimethylallyladenosine37-tRNAs 6-Dimethylallyladenosine37-tRNAs] == * common name: ** N6-dime...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6-Dimethylallyladenosine37-tRNAs 6-Dimethylallyladenosine37-tRNAs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N6-dimethylallyladenosine37 in tRNA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-methylthio-N-dimethylallyladenosine37 in tRNA |
− | + | ** tRNA-(2-methylthio-N-6-dimethylallyladenosine) | |
− | ** | + | |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-5063]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-6274]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-14480]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: common name=N6-dimethylallyladenosine37 in tRNA}} | |
− | + | {{#set: common name=2-methylthio-N-dimethylallyladenosine37 in tRNA|tRNA-(2-methylthio-N-6-dimethylallyladenosine)}} | |
− | + | {{#set: consumed by=RXN0-5063}} | |
− | + | {{#set: produced by=RXN0-6274}} | |
− | + | {{#set: reversible reaction associated=RXN-14480}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: produced by= | + | |
− | {{#set: reversible reaction associated= | + |
Latest revision as of 20:35, 21 March 2018
Contents
Metabolite 6-Dimethylallyladenosine37-tRNAs
- common name:
- N6-dimethylallyladenosine37 in tRNA
- Synonym(s):
- 2-methylthio-N-dimethylallyladenosine37 in tRNA
- tRNA-(2-methylthio-N-6-dimethylallyladenosine)