Difference between revisions of "Ec-12 008700"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Ec-12_008700 == * left end position: ** 7787793 * transcription direction: ** NEGATIVE * right end position: ** 7801112 * centisome position: ** 93.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_008700 == |
− | * | + | * left end position: |
− | ** | + | ** 7787793 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7801112 |
− | * | + | * centisome position: |
− | ** | + | ** 93.42304 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0067_0026 |
− | ** | + | ** Esi0067_0026 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7787793}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7801112}} | |
− | + | {{#set: centisome position=93.42304 }} | |
− | + | {{#set: common name=Esi_0067_0026|Esi0067_0026}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:35, 21 March 2018
Gene Ec-12_008700
- left end position:
- 7787793
- transcription direction:
- NEGATIVE
- right end position:
- 7801112
- centisome position:
- 93.42304
- Synonym(s):
- Esi_0067_0026
- Esi0067_0026
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome