Difference between revisions of "RXN-15131"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] == * direction: ** LEFT-TO-RIGHT * common name: ** Cys/Met metabolism, pyridox...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] ==
−
* smiles:
+
* direction:
−
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PSXWNITXWWECNY-UCBTUHGZSA-L
+
 
* common name:
 
* common name:
−
** dTDP-4-dehydro-6-deoxy-α-D-glucopyranose
+
** Cys/Met metabolism, pyridoxal phosphate-dependent enzyme
−
* molecular weight:
+
** Cystathionine beta-lyase
−
** 544.302   
+
 
* Synonym(s):
 
* Synonym(s):
−
** TDP-4-keto-6-deoxy--α-D-glucose
 
−
** TDP-4-oxo-6-deoxy--α-D-glucose
 
−
** dTDP-4-oxo-6-deoxy--α-D-glucose
 
−
** dTDP-6-deoxy-α-D-xylo-4-hexosulose
 
−
** dTDP-6-deoxy-α-D-xylohex-4-ulose
 
−
** dTDP-4-dehydro-6-deoxy-α-D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DTDPGLUCDEHYDRAT-RXN]]
+
** 1 [[L-CYSTATHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[2-AMINOACRYLATE]][c] '''+''' 1 [[HOMO-CYS]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-cystathionine[c] '''=>''' 1 H+[c] '''+''' 1 2-aminoprop-2-enoate[c] '''+''' 1 L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_002820]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-05_006760]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[HOMOSER-METSYN-PWY]], L-methionine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 35701
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Cys/Met metabolism, pyridoxal phosphate-dependent enzyme}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244163 25244163]
+
{{#set: common name=Cystathionine beta-lyase}}
−
* HMDB : HMDB01399
+
{{#set: gene associated=Ec-00_002820|Ec-05_006760}}
−
* LIGAND-CPD:
+
{{#set: in pathway=HOMOSER-METSYN-PWY|PWY-801|PWY-702}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11907 C11907]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57649 57649]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC57649
+
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))}}
+
−
{{#set: inchi key=InChIKey=PSXWNITXWWECNY-UCBTUHGZSA-L}}
+
−
{{#set: common name=dTDP-4-dehydro-6-deoxy-α-D-glucopyranose}}
+
−
{{#set: molecular weight=544.302    }}
+
−
{{#set: common name=TDP-4-keto-6-deoxy--α-D-glucose|TDP-4-oxo-6-deoxy--α-D-glucose|dTDP-4-oxo-6-deoxy--α-D-glucose|dTDP-6-deoxy-α-D-xylo-4-hexosulose|dTDP-6-deoxy-α-D-xylohex-4-ulose|dTDP-4-dehydro-6-deoxy-α-D-glucose}}
+
−
{{#set: produced by=DTDPGLUCDEHYDRAT-RXN}}
+

Latest revision as of 19:35, 21 March 2018

Reaction RXN-15131

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Cys/Met metabolism, pyridoxal phosphate-dependent enzyme
    • Cystathionine beta-lyase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • HOMOSER-METSYN-PWY, L-methionine biosynthesis I: HOMOSER-METSYN-PWY
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-801, L-homocysteine and L-cysteine interconversion: PWY-801
    • 3 reactions found over 4 reactions in the full pathway
  • PWY-702, L-methionine biosynthesis II: PWY-702
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15131&oldid=28034"