Difference between revisions of "RXN-5821"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5821 RXN-5821] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5821 RXN-5821] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OC(O)C(O)C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
+
** [http://enzyme.expasy.org/EC/1.4.3.4 EC-1.4.3.4]
−
* common name:
+
−
** β-D-galactose
+
−
* molecular weight:
+
−
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-galactopyranose
 
−
** cerebrose
 
−
** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[BETAGALACTOSID-RXN]]
+
** 1 [[TYRAMINE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDRPHENYLAC-CPD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[ALDOSE1EPIM-RXN]]
+
** 1 tyramine[c] '''+''' 1 H2O[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 ammonium[c] '''+''' 1 (4-hydroxyphenyl)acetaldehyde[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-15_002910]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-15_002920]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-7431]], aromatic biogenic amine degradation (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7431 PWY-7431]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-6802]], salidroside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6802 PWY-6802]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 7296-64-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30592 30592]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439353 439353]
+
* LIGAND-RXN:
−
* HMDB : HMDB03449
+
** [http://www.genome.jp/dbget-bin/www_bget?R02382 R02382]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00962 C00962]
+
{{#set: ec number=EC-1.4.3.4}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Ec-15_002910|Ec-15_002920}}
−
** [http://www.chemspider.com/Chemical-Structure.388476.html 388476]
+
{{#set: in pathway=PWY-7431|PWY-6802}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28034 28034]
+
{{#set: reconstruction source=orthology-aragem}}
−
* BIGG : 37923
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N}}
+
−
{{#set: common name=β-D-galactose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: common name=β-D-galactopyranose|cerebrose|6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}}
+
−
{{#set: produced by=BETAGALACTOSID-RXN}}
+
−
{{#set: reversible reaction associated=ALDOSE1EPIM-RXN}}
+

Latest revision as of 20:36, 21 March 2018

Reaction RXN-5821

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7431, aromatic biogenic amine degradation (bacteria): PWY-7431
    • 2 reactions found over 8 reactions in the full pathway
  • PWY-6802, salidroside biosynthesis: PWY-6802
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-5821&oldid=28097"