Difference between revisions of "Ec-14 000790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * smiles: ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] * inchi key: ** InChIKey=O...") |
(Created page with "Category:Gene == Gene Ec-14_000790 == * left end position: ** 753692 * transcription direction: ** POSITIVE * right end position: ** 760106 * centisome position: ** 11.488...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_000790 == |
− | * | + | * left end position: |
− | ** | + | ** 753692 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 760106 |
− | * | + | * centisome position: |
− | ** | + | ** 11.488458 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0029_0126 |
− | ** | + | ** Esi0029_0126 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.2.1.84-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=753692}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=760106}} | |
− | + | {{#set: centisome position=11.488458 }} | |
− | + | {{#set: common name=Esi_0029_0126|Esi0029_0126}} | |
− | + | {{#set: reaction associated=3.2.1.84-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:37, 21 March 2018
Gene Ec-14_000790
- left end position:
- 753692
- transcription direction:
- POSITIVE
- right end position:
- 760106
- centisome position:
- 11.488458
- Synonym(s):
- Esi_0029_0126
- Esi0029_0126
Reactions associated
- Reaction: 3.2.1.84-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome