Difference between revisions of "RXN-17352"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17352 RXN-17352] == * direction: ** LEFT-TO-RIGHT * common name: ** peroxidase * ec number: **...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17352 RXN-17352] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
+
 
* common name:
 
* common name:
−
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** peroxidase
−
* molecular weight:
+
* ec number:
−
** 744.043   
+
** [http://enzyme.expasy.org/EC/1.11.1.7 EC-1.11.1.7]
 
* Synonym(s):
 
* Synonym(s):
−
** phosphatidylethanolamine (1-18:1-2-18:1)
 
−
** 18:1-18:1-PE
 
−
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15067]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 2 [[CONIFERYL-ALCOHOL]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[CPD-18761]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-15036]]
+
** 1 hydrogen peroxide[c] '''+''' 2 coniferyl alcohol[c] '''=>''' 2 H2O[c] '''+''' 2 coniferyl alcohol radical[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-24_002370]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-00_008250]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-02_001740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-17_002450]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-00_008210]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-17_002430]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-02_003170]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-19_000230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-24_002030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-19_001450]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-14_002880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-02_001880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-02_000470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-05_003380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-28_003740]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-20_002770]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-00_008240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-00_008220]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-08_006020]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_003410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_001530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-02_001210]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_003550]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-27_004950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-26_000310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-00_010030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-05_002520]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-16_000240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-04_004690]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-6824]], justicidin B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6824 PWY-6824]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-5466]], matairesinol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5466 PWY-5466]
 +
** '''1''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-5469]], sesamin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5469 PWY-5469]
 +
** '''1''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425]
+
{{#set: common name=peroxidase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.11.1.7}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986]
+
{{#set: gene associated=Ec-24_002370|Ec-00_008250|Ec-02_001740|Ec-17_002450|Ec-00_008210|Ec-17_002430|Ec-02_003170|Ec-19_000230|Ec-24_002030|Ec-19_001450|Ec-14_002880|Ec-14_006530|Ec-02_001880|Ec-02_000470|Ec-05_003380|Ec-28_003740|Ec-20_002770|Ec-00_008240|Ec-00_008220|Ec-08_006020|Ec-11_003410|Ec-11_001530|Ec-02_001210|Ec-06_003550|Ec-27_004950|Ec-26_000310|Ec-00_010030|Ec-05_002520|Ec-16_000240|Ec-04_004690}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}}
+
{{#set: in pathway=PWY-6824|PWY-5466|PWY-5469}}
−
{{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=744.043    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: consumed by=RXN-15067}}
+
−
{{#set: reversible reaction associated=RXN-15036}}
+

Latest revision as of 20:38, 21 March 2018

Reaction RXN-17352

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • peroxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6824, justicidin B biosynthesis: PWY-6824
    • 1 reactions found over 6 reactions in the full pathway
  • PWY-5466, matairesinol biosynthesis: PWY-5466
    • 1 reactions found over 10 reactions in the full pathway
  • PWY-5469, sesamin biosynthesis: PWY-5469
    • 1 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17352&oldid=28311"