Difference between revisions of "Ec-19 004010"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
(Created page with "Category:Gene == Gene Ec-19_004010 == * left end position: ** 4354332 * transcription direction: ** NEGATIVE * right end position: ** 4366157 * centisome position: ** 72.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_004010 == |
− | * | + | * left end position: |
− | ** | + | ** 4354332 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4366157 |
− | * | + | * centisome position: |
− | ** | + | ** 72.92848 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0088_0081 |
− | ** | + | ** Esi0088_0081 |
− | ** | + | ** NADPH oxidase |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-10745]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=4354332}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4366157}} | |
− | + | {{#set: centisome position=72.92848 }} | |
− | + | {{#set: common name=Esi_0088_0081|Esi0088_0081|NADPH oxidase}} | |
− | + | {{#set: reaction associated=RXN-10745}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Gene Ec-19_004010
- left end position:
- 4354332
- transcription direction:
- NEGATIVE
- right end position:
- 4366157
- centisome position:
- 72.92848
- Synonym(s):
- Esi_0088_0081
- Esi0088_0081
- NADPH oxidase
Reactions associated
- Reaction: RXN-10745
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome