Difference between revisions of "Ec-02 003100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...")
(Created page with "Category:Gene == Gene Ec-02_003100 == * left end position: ** 3429694 * transcription direction: ** NEGATIVE * right end position: ** 3439284 * centisome position: ** 52.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] ==
+
== Gene Ec-02_003100 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
+
** 3429694
−
* common name:
+
* transcription direction:
−
** magnesium-protoporphyrin IX 13-monomethyl ester
+
** NEGATIVE
−
* molecular weight:
+
* right end position:
−
** 597.975    
+
** 3439284
 +
* centisome position:
 +
** 52.539886    
 
* Synonym(s):
 
* Synonym(s):
−
** Mg-protoporphyrin monomethyl ester
+
** Esi_0209_0031
−
** magnesium protoporphyrin monomethyl ester
+
** Esi0209_0031
−
** MgPMME
+
** MDH
−
** magnesium-protoporphyrin IX 13-methyl ester
+
−
** MgP monomethyl ester
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[MALATE-DEH-RXN]]
−
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-561]]
 +
* [[PWY-5913]]
 +
* [[PWY-1622]]
 +
* [[GLUCONEO-PWY]]
 +
* [[P42-PWY]]
 +
* [[MALATE-ASPARTATE-SHUTTLE-PWY]]
 +
* [[PWY-5392]]
 +
* [[PWY-7383]]
 +
* [[PWY66-398]]
 +
* [[P23-PWY]]
 +
* [[PWY66-399]]
 +
* [[P105-PWY]]
 +
* [[GLYOXYLATE-BYPASS]]
 +
* [[FERMENTATION-PWY]]
 +
* [[PWY-6728]]
 +
* [[PWY-7115]]
 +
* [[P108-PWY]]
 +
* [[PWY-5690]]
 +
* [[PWY-6969]]
 +
* [[TCA]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3429694}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3439284}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491]
+
{{#set: centisome position=52.539886   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0209_0031|Esi0209_0031|MDH}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536]
+
{{#set: reaction associated=MALATE-DEH-RXN}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}}
+
{{#set: pathway associated=PWY-561|PWY-5913|PWY-1622|GLUCONEO-PWY|P42-PWY|MALATE-ASPARTATE-SHUTTLE-PWY|PWY-5392|PWY-7383|PWY66-398|P23-PWY|PWY66-399|P105-PWY|GLYOXYLATE-BYPASS|FERMENTATION-PWY|PWY-6728|PWY-7115|P108-PWY|PWY-5690|PWY-6969|TCA}}
−
{{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=597.975   }}
+
−
{{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}}
+
−
{{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+

Latest revision as of 19:38, 21 March 2018

Gene Ec-02_003100

  • left end position:
    • 3429694
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3439284
  • centisome position:
    • 52.539886
  • Synonym(s):
    • Esi_0209_0031
    • Esi0209_0031
    • MDH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_003100&oldid=28333"