Difference between revisions of "RXN1G-488"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-488 RXN1G-488] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-docos-2-enoyl-[acyl-c...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-488 RXN1G-488] ==
−
* smiles:
+
* direction:
−
** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L
+
 
* common name:
 
* common name:
−
** 7,8-dihydroneopterin 3'-phosphate
+
** trans-docos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
−
* molecular weight:
+
** Glucose/ribitol dehydrogenase
−
** 333.197   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** dihydroneopterin 3'-monophosphate
 
−
** dihydroneopterin-P
 
−
** 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate
 
−
** dihydroneopterin 3'-phosphate
 
−
** 7,8-dihydro-D-neopterin 3'-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[trans-delta2-behenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Behenoyl-ACPs]][c]
−
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a trans-docos-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 NAD+[c] '''+''' 1 a behenoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''30''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05925 C05925]
+
{{#set: common name=trans-docos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)}}
−
* CHEBI:
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58762 58762]
+
{{#set: ec number=EC-1.3.1.9}}
−
* BIGG : 1447045
+
{{#set: gene associated=Ec-27_002470}}
−
* PUBCHEM:
+
{{#set: in pathway=PWYG-321}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245170 25245170]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB06824
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L}}
+
−
{{#set: common name=7,8-dihydroneopterin 3'-phosphate}}
+
−
{{#set: molecular weight=333.197    }}
+
−
{{#set: common name=dihydroneopterin 3'-monophosphate|dihydroneopterin-P|2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate|dihydroneopterin 3'-phosphate|7,8-dihydro-D-neopterin 3'-phosphate}}
+
−
{{#set: consumed by=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN}}
+
−
{{#set: produced by=H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}}
+

Latest revision as of 19:38, 21 March 2018

Reaction RXN1G-488

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-docos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 30 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-docos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN1G-488&oldid=28336"