Difference between revisions of "Trans-3-enoyl-CoAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-3-enoyl-CoAs Trans-3-enoyl-CoAs] == * common name: ** a trans-3-enoyl-CoA * Synonym(s):...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-3-enoyl-CoAs Trans-3-enoyl-CoAs] ==
* smiles:
+
** C(O)C(=O)C(O)C(O)C(O)CO
+
* inchi key:
+
** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N
+
 
* common name:
 
* common name:
** keto-D-fructose
+
** a trans-3-enoyl-CoA
* molecular weight:
+
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14515]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7835]]
 +
* [[RXN-12521]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-7644]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans-3-enoyl-CoA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984]
+
{{#set: produced by=RXN-7835|RXN-12521}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095]
+
* METABOLIGHTS : MTBLC48095
+
{{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}}
+
{{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}}
+
{{#set: common name=keto-D-fructose}}
+
{{#set: molecular weight=180.157    }}
+
{{#set: consumed by=RXN-14515}}
+
{{#set: reversible reaction associated=RXN-7644}}
+

Latest revision as of 19:38, 21 March 2018

Metabolite Trans-3-enoyl-CoAs

  • common name:
    • a trans-3-enoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links