Difference between revisions of "Ec-25 002400"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) * in...") |
(Created page with "Category:Gene == Gene Ec-25_002400 == * left end position: ** 2682714 * transcription direction: ** POSITIVE * right end position: ** 2696376 * centisome position: ** 60.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_002400 == |
− | * | + | * left end position: |
− | ** | + | ** 2682714 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2696376 |
− | * | + | * centisome position: |
− | ** | + | ** 60.273003 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0108_0047 |
− | ** | + | ** Esi0108_0047 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[QUINOLINATE-SYNTHA-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[QUINOLINATE-SYNTHE-MULTI-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5316]] | ||
+ | * [[PWY-7342]] | ||
+ | * [[PYRIDNUCSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2682714}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2696376}} | |
− | + | {{#set: centisome position=60.273003 }} | |
− | + | {{#set: common name=Esi_0108_0047|Esi0108_0047}} | |
− | + | {{#set: reaction associated=QUINOLINATE-SYNTHA-RXN|QUINOLINATE-SYNTHE-MULTI-RXN}} | |
− | + | {{#set: pathway associated=PWY-5316|PWY-7342|PYRIDNUCSYN-PWY}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Gene Ec-25_002400
- left end position:
- 2682714
- transcription direction:
- POSITIVE
- right end position:
- 2696376
- centisome position:
- 60.273003
- Synonym(s):
- Esi_0108_0047
- Esi0108_0047
Reactions associated
- Reaction: QUINOLINATE-SYNTHA-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: QUINOLINATE-SYNTHE-MULTI-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome