Difference between revisions of "SUCC-S-ALD"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_008040 == * left end position: ** 6908895 * transcription direction: ** POSITIVE * right end position: ** 6912893 * centisome position: ** 66.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCC-S-ALD SUCC-S-ALD] == * smiles: ** C([CH]=O)CC(=O)[O-] * inchi key: ** InChIKey=UIUJIQZEACW...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCC-S-ALD SUCC-S-ALD] == |
− | * | + | * smiles: |
− | ** | + | ** C([CH]=O)CC(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UIUJIQZEACWQSV-UHFFFAOYSA-M |
− | * | + | * common name: |
− | ** | + | ** succinate semialdehyde |
− | * | + | * molecular weight: |
− | ** | + | ** 101.082 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** succinyl semialdehyde |
− | ** | + | ** succ-S-ald |
− | ** | + | ** succinic semialdehyde |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14146]] | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 692-29-5 |
− | {{#set: | + | * BIGG : 34331 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543238 9543238] |
− | {{#set: common name= | + | * HMDB : HMDB01259 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00232 C00232] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.7822211.html 7822211] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57706 57706] | ||
+ | * METABOLIGHTS : MTBLC57706 | ||
+ | {{#set: smiles=C([CH]=O)CC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=UIUJIQZEACWQSV-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=succinate semialdehyde}} | ||
+ | {{#set: molecular weight=101.082 }} | ||
+ | {{#set: common name=succinyl semialdehyde|succ-S-ald|succinic semialdehyde}} | ||
+ | {{#set: produced by=4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14146}} |
Latest revision as of 20:38, 21 March 2018
Contents
Metabolite SUCC-S-ALD
- smiles:
- C([CH]=O)CC(=O)[O-]
- inchi key:
- InChIKey=UIUJIQZEACWQSV-UHFFFAOYSA-M
- common name:
- succinate semialdehyde
- molecular weight:
- 101.082
- Synonym(s):
- succinyl semialdehyde
- succ-S-ald
- succinic semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 692-29-5
- BIGG : 34331
- PUBCHEM:
- HMDB : HMDB01259
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57706
"C([CH]=O)CC(=O)[O-" cannot be used as a page name in this wiki.