Difference between revisions of "RXN-17794"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17794 RXN-17794] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17794 RXN-17794] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 6-phosphogluconate dehydrogenase, C-terminal-like |
| − | * | + | ** 3-hydroxyacyl-CoA dehydrogenase |
| − | ** | + | * ec number: |
| + | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[CPD-19154]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-19157]][c] | |
| − | * [[1 | + | * With common name(s): |
| − | == | + | ** 1 (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA[c] '''+''' 1 NAD+[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 3-oxo-(7Z)-tetradecenoyl-CoA[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Ec-19_005290]] |
| − | == | + | ** Source: [[annotation-esiliculosus_genome]] |
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Ec-14_006530]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: GO-TERM | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}} | |
| − | + | {{#set: common name=3-hydroxyacyl-CoA dehydrogenase}} | |
| − | + | {{#set: ec number=EC-1.1.1.35}} | |
| − | + | {{#set: gene associated=Ec-19_005290|Ec-14_006530}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:38, 21 March 2018
Contents
Reaction RXN-17794
- direction:
- LEFT-TO-RIGHT
- common name:
- 6-phosphogluconate dehydrogenase, C-terminal-like
- 3-hydroxyacyl-CoA dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA[c] + 1 NAD+[c] => 1 NADH[c] + 1 H+[c] + 1 3-oxo-(7Z)-tetradecenoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-19_005290
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-14_006530
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
