Difference between revisions of "CPD-1302"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_002420 == * left end position: ** 2618207 * transcription direction: ** NEGATIVE * right end position: ** 2648516 * centisome position: ** 43.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * smiles: ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == |
| − | * | + | * smiles: |
| − | ** | + | ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J |
| − | * | + | * common name: |
| − | ** | + | ** N5-methyl--tetrahydropteroyl tri-L-glutamate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 713.66 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N5-methyl--H4PteGlu3 |
| − | ** | + | ** 5-methyltetrahydropteroyl tri-L-glutamate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12730]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[HOMOCYSMET-RXN]] |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852302 49852302] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.17625689.html 17625689] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489] | ||
| + | * HMDB : HMDB12177 | ||
| + | {{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}} | ||
| + | {{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}} | ||
| + | {{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}} | ||
| + | {{#set: molecular weight=713.66 }} | ||
| + | {{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}} | ||
| + | {{#set: consumed by=RXN-12730}} | ||
| + | {{#set: reversible reaction associated=HOMOCYSMET-RXN}} | ||
Latest revision as of 19:39, 21 March 2018
Contents
Metabolite CPD-1302
- smiles:
- CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
- inchi key:
- InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
- common name:
- N5-methyl--tetrahydropteroyl tri-L-glutamate
- molecular weight:
- 713.66
- Synonym(s):
- N5-methyl--H4PteGlu3
- 5-methyltetrahydropteroyl tri-L-glutamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))" cannot be used as a page name in this wiki.
