Difference between revisions of "Ec-23 000950"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(=C(O2)C=C(O)C(O)=C(O)3))) * inc...") |
(Created page with "Category:Gene == Gene Ec-23_000950 == * left end position: ** 972358 * transcription direction: ** NEGATIVE * right end position: ** 980748 * centisome position: ** 20.092...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_000950 == |
− | * | + | * left end position: |
− | ** | + | ** 972358 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 980748 |
− | * | + | * centisome position: |
− | ** | + | ** 20.092253 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0017_0146 |
+ | ** Esi0017_0146 | ||
+ | ** CK | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[RXN-8443]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=972358}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=980748}} | |
− | + | {{#set: centisome position=20.092253 }} | |
− | + | {{#set: common name=Esi_0017_0146|Esi0017_0146|CK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN|RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:40, 21 March 2018
Gene Ec-23_000950
- left end position:
- 972358
- transcription direction:
- NEGATIVE
- right end position:
- 980748
- centisome position:
- 20.092253
- Synonym(s):
- Esi_0017_0146
- Esi0017_0146
- CK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8443
- Source: orthology-aragem