Difference between revisions of "CPD-13040"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_005510 == * left end position: ** 5511573 * transcription direction: ** POSITIVE * right end position: ** 5516739 * centisome position: ** 87.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == * smiles: ** CCCC(OCC(OC(CCC)=O)CO)=O * inchi key: ** InChIKey=AWHAUPZH...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCC(OCC(OC(CCC)=O)CO)=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N |
| − | * | + | * common name: |
| − | ** | + | ** 1,2-dibutyrin |
| − | * | + | * molecular weight: |
| − | ** | + | ** 232.276 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** glycerol 1,2-dibutanoate |
| − | ** | + | ** β-dibutyrin |
| + | ** butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester | ||
| + | ** dibutyrylglycerol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-12086]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CAS : 24814-35-5 | |
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327007 5327007] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.8352519.html 8352519] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76537 76537] |
| + | {{#set: smiles=CCCC(OCC(OC(CCC)=O)CO)=O}} | ||
| + | {{#set: inchi key=InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N}} | ||
| + | {{#set: common name=1,2-dibutyrin}} | ||
| + | {{#set: molecular weight=232.276 }} | ||
| + | {{#set: common name=glycerol 1,2-dibutanoate|β-dibutyrin|butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester|dibutyrylglycerol}} | ||
| + | {{#set: produced by=RXN-12086}} | ||
Latest revision as of 20:40, 21 March 2018
Contents
Metabolite CPD-13040
- smiles:
- CCCC(OCC(OC(CCC)=O)CO)=O
- inchi key:
- InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N
- common name:
- 1,2-dibutyrin
- molecular weight:
- 232.276
- Synonym(s):
- glycerol 1,2-dibutanoate
- β-dibutyrin
- butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
- dibutyrylglycerol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
