Difference between revisions of "RXN-14776"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CO)(O)C(O)C(O)1) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14776 RXN-14776] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14776 RXN-14776] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** NAD(P)-binding domain |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.34 EC-1.3.1.34] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-15654]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-15655]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 2-trans, 4-cis-undecadienoyl-CoA[c] '''=>''' 1 NADP+[c] '''+''' 1 3-trans-undecenoyl-CoA[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | * [[ | + | * Gene: [[Ec-16_003950]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY-7337]], 10-cis-heptadecenoyl-CoA degradation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7337 PWY-7337] |
− | * [[ | + | ** '''3''' reactions found over '''12''' reactions in the full pathway |
− | * [[ | + | == Reconstruction information == |
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=NAD(P)-binding domain}} | |
− | + | {{#set: ec number=EC-1.3.1.34}} | |
− | + | {{#set: gene associated=Ec-16_003950}} | |
− | + | {{#set: in pathway=PWY-7337}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:40, 21 March 2018
Contents
Reaction RXN-14776
- direction:
- LEFT-TO-RIGHT
- common name:
- NAD(P)-binding domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADPH[c] + 1 H+[c] + 1 2-trans, 4-cis-undecadienoyl-CoA[c] => 1 NADP+[c] + 1 3-trans-undecenoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_003950
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7337, 10-cis-heptadecenoyl-CoA degradation (yeast): PWY-7337
- 3 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome