Difference between revisions of "CPD-1137"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-10_001280 == * left end position: ** 1385828 * transcription direction: ** POSITIVE * right end position: ** 1390248 * centisome position: ** 21.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] == * smiles: ** C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NFVGYLGSSJPRKW-CITAKDKDSA-I |
| − | * | + | * common name: |
| − | ** | + | ** itaconyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 874.579 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-8988]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00531 C00531] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57381 57381] |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC57381 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266606 45266606] |
| + | * HMDB : HMDB03377 | ||
| + | {{#set: smiles=C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=NFVGYLGSSJPRKW-CITAKDKDSA-I}} | ||
| + | {{#set: common name=itaconyl-CoA}} | ||
| + | {{#set: molecular weight=874.579 }} | ||
| + | {{#set: produced by=RXN-8988}} | ||
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite CPD-1137
- smiles:
- C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O
- inchi key:
- InChIKey=NFVGYLGSSJPRKW-CITAKDKDSA-I
- common name:
- itaconyl-CoA
- molecular weight:
- 874.579
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O" cannot be used as a page name in this wiki.
