Difference between revisions of "PHENYL"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-115 RXN-115] == * direction: ** LEFT-TO-RIGHT * common name: ** Non-haem dioxygenase N-terminal...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)C1(C=CC=CC=1) |
+ | * inchi key: | ||
+ | ** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** acetophenone |
− | * | + | * molecular weight: |
− | ** | + | ** 120.151 |
* Synonym(s): | * Synonym(s): | ||
+ | ** phenylmethylketone | ||
+ | ** methylphenylketone | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-1302]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 98-86-2 |
− | ** [http:// | + | * DRUGBANK : DB04619 |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410] |
− | + | * HMDB : HMDB33910 | |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.7132.html 7132] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632] |
− | {{#set: | + | {{#set: smiles=CC(=O)C1(C=CC=CC=1)}} |
+ | {{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=acetophenone}} | ||
+ | {{#set: molecular weight=120.151 }} | ||
+ | {{#set: common name=phenylmethylketone|methylphenylketone}} | ||
+ | {{#set: reversible reaction associated=RXN-1302}} |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite PHENYL
- smiles:
- CC(=O)C1(C=CC=CC=1)
- inchi key:
- InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N
- common name:
- acetophenone
- molecular weight:
- 120.151
- Synonym(s):
- phenylmethylketone
- methylphenylketone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 98-86-2
- DRUGBANK : DB04619
- PUBCHEM:
- HMDB : HMDB33910
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: