Difference between revisions of "C-DI-GMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Galactosyl-galactosyl-diacyl-glycerols Galactosyl-galactosyl-diacyl-glycerols] == * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] == * smiles: ** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] == |
+ | * smiles: | ||
+ | ** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** cyclic di-3',5'-guanylate |
+ | * molecular weight: | ||
+ | ** 688.4 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cyclic di-3',5'-GMP |
− | ** | + | ** c-di-GMP |
− | ** | + | ** c-di-guanylate |
− | ** | + | ** cyclic bis(3' -> 5') dimeric GMP |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-5359]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245336 25245336] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58805 58805] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16463 C16463] | ||
+ | {{#set: smiles=C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))}} | ||
+ | {{#set: inchi key=InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L}} | ||
+ | {{#set: common name=cyclic di-3',5'-guanylate}} | ||
+ | {{#set: molecular weight=688.4 }} | ||
+ | {{#set: common name=cyclic di-3',5'-GMP|c-di-GMP|c-di-guanylate|cyclic bis(3' -> 5') dimeric GMP}} | ||
+ | {{#set: produced by=RXN0-5359}} |
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite C-DI-GMP
- smiles:
- C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))
- inchi key:
- InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L
- common name:
- cyclic di-3',5'-guanylate
- molecular weight:
- 688.4
- Synonym(s):
- cyclic di-3',5'-GMP
- c-di-GMP
- c-di-guanylate
- cyclic bis(3' -> 5') dimeric GMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))" cannot be used as a page name in this wiki.
"cyclic bis(3' -> 5') dimeric GMP" cannot be used as a page name in this wiki.