Difference between revisions of "CPD-4203"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-07_007360 == * left end position: ** 7077551 * transcription direction: ** NEGATIVE * right end position: ** 7086267 * centisome position: ** 91.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-07_007360 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] ==
−
* left end position:
+
* smiles:
−
** 7077551
+
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
−
* right end position:
+
* common name:
−
** 7086267
+
** N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
−
* centisome position:
+
* molecular weight:
−
** 91.64928    
+
** 492.298    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0305_0010
+
** iPDP
−
** Esi0305_0010
+
** isopentenyladenosine riboside-5'-diphosphate
−
** P5CR
+
** iPRDP
 +
** isopentenyladenosine-5'-diphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[PYRROLINECARBREDUCT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Source: [[annotation-esiliculosus_genome]]
+
* [[RXN-4305]]
−
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
−
* Reaction: [[RXN66-546]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: ec-number
+
−
== Pathways associated ==
+
−
* [[PROSYN-PWY]]
+
−
* [[ARG-PRO-PWY]]
+
−
* [[PWY-6344]]
+
−
* [[PWY-4981]]
+
−
* [[PWY-3341]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7077551}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202829 25202829]
−
{{#set: right end position=7086267}}
+
* CHEBI:
−
{{#set: centisome position=91.64928   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73533 73533]
−
{{#set: common name=Esi_0305_0010|Esi0305_0010|P5CR}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=PYRROLINECARBREDUCT-RXN|RXN66-546}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16426 C16426]
−
{{#set: pathway associated=PROSYN-PWY|ARG-PRO-PWY|PWY-6344|PWY-4981|PWY-3341}}
+
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C}}
 +
{{#set: inchi key=InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K}}
 +
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate}}
 +
{{#set: molecular weight=492.298   }}
 +
{{#set: common name=iPDP|isopentenyladenosine riboside-5'-diphosphate|iPRDP|isopentenyladenosine-5'-diphosphate}}
 +
{{#set: produced by=RXN-4305}}

Latest revision as of 19:42, 21 March 2018

Metabolite CPD-4203

  • smiles:
    • CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
  • inchi key:
    • InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
  • common name:
    • N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
  • molecular weight:
    • 492.298
  • Synonym(s):
    • iPDP
    • isopentenyladenosine riboside-5'-diphosphate
    • iPRDP
    • isopentenyladenosine-5'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-4203&oldid=28783"