Difference between revisions of "CPD-1130"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-04_000570 == * left end position: ** 644408 * transcription direction: ** NEGATIVE * right end position: ** 650383 * centisome position: ** 9.8959...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C(=O)[O-])C(C([O-])=O)O * inchi key: ** InChIKey=JUCRENB...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC(C(=O)[O-])C(C([O-])=O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 3-ethylmalate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 160.126 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-14986]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145023 21145023] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20015785.html 20015785] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57425 57425] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01989 C01989] | ||
| + | {{#set: smiles=CCC(C(=O)[O-])C(C([O-])=O)O}} | ||
| + | {{#set: inchi key=InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=3-ethylmalate}} | ||
| + | {{#set: molecular weight=160.126 }} | ||
| + | {{#set: consumed by=RXN-14986}} | ||
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite CPD-1130
- smiles:
- CCC(C(=O)[O-])C(C([O-])=O)O
- inchi key:
- InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
- common name:
- 3-ethylmalate
- molecular weight:
- 160.126
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C(=O)[O-])C(C([O-])=O)O" cannot be used as a page name in this wiki.
