Difference between revisions of "CPD-12015"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-24_002750 == * left end position: ** 3019429 * transcription direction: ** NEGATIVE * right end position: ** 3029972 * centisome position: ** 60.5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-24_002750 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
−
* left end position:
+
* smiles:
−
** 3019429
+
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
−
* right end position:
+
* common name:
−
** 3029972
+
** 6-sulfatoxymelatonin
−
* centisome position:
+
* molecular weight:
−
** 60.537846    
+
** 327.331    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0340_0006
+
** 6-sulphatoxymelatonin
−
** Esi0340_0006
+
** 6-hydroxymelatoninsulfate
−
** MEP26
+
** 6-hydroxymelatonin sulfate ester
 +
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[RXN-9839]]
+
== Reaction(s) known to produce the compound ==
−
** Source: [[annotation-esiliculosus_genome]]
+
* [[RXN-11058]]
−
*** Assignment: automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6082]]
+
−
* [[PWY-6073]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3019429}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65096 65096]
−
{{#set: right end position=3029972}}
+
* CHEMSPIDER:
−
{{#set: centisome position=60.537846   }}
+
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
−
{{#set: common name=Esi_0340_0006|Esi0340_0006|MEP26}}
+
* HMDB : HMDB41815
−
{{#set: reaction associated=RXN-9839}}
+
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
−
{{#set: pathway associated=PWY-6082|PWY-6073}}
+
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
 +
{{#set: common name=6-sulfatoxymelatonin}}
 +
{{#set: molecular weight=327.331   }}
 +
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
 +
{{#set: produced by=RXN-11058}}

Latest revision as of 20:42, 21 March 2018

Metabolite CPD-12015

  • smiles:
    • CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
  • inchi key:
    • InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
  • common name:
    • 6-sulfatoxymelatonin
  • molecular weight:
    • 327.331
  • Synonym(s):
    • 6-sulphatoxymelatonin
    • 6-hydroxymelatoninsulfate
    • 6-hydroxymelatonin sulfate ester
    • acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • CHEMSPIDER:
  • HMDB : HMDB41815
"CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12015&oldid=28827"