Difference between revisions of "ACP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACP ACP] == * common name: ** a holo-[acyl-carrier protein] * Synonym(s): ** a holo-ACP ** a ho...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACP ACP] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a holo-[acyl-carrier protein] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a holo-ACP | ||
+ | ** a holo-[acp] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[3.1.4.14-RXN]] |
+ | * [[RXN-17155]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11474]] | ||
+ | * [[RXN-17013]] | ||
+ | * [[RXN-17012]] | ||
+ | * [[RXN-17015]] | ||
+ | * [[RXN-16615]] | ||
+ | * [[RXN-17017]] | ||
+ | * [[RXN-17016]] | ||
+ | * [[RXN-17018]] | ||
+ | * [[RXN-16067]] | ||
+ | * [[RXN-16025]] | ||
+ | * [[RXN-16024]] | ||
+ | * [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]] | ||
+ | * [[RXN-17014]] | ||
+ | * [[RXN-14972]] | ||
+ | * [[RXN3O-1803]] | ||
+ | * [[RXN-11484]] | ||
+ | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] | ||
+ | * [[2.3.1.179-RXN]] | ||
+ | * [[RXN-9523]] | ||
+ | * [[RXN0-6705]] | ||
+ | * [[RXN-10654]] | ||
+ | * [[RXN-10462]] | ||
+ | * [[RXN-17020]] | ||
+ | * [[RXN-10658]] | ||
+ | * [[RXN0-5514]] | ||
+ | * [[RXN-17024]] | ||
+ | * [[RXN-9549]] | ||
+ | * [[RXN-9548]] | ||
+ | * [[RXN-16629]] | ||
+ | * [[RXN-9527]] | ||
+ | * [[RXN-16621]] | ||
+ | * [[RXN-11479]] | ||
+ | * [[RXN-16076]] | ||
+ | * [[RXN-16077]] | ||
+ | * [[RXN-16625]] | ||
+ | * [[HOLO-ACP-SYNTH-RXN]] | ||
+ | * [[RXN0-2141]] | ||
+ | * [[RXN-17022]] | ||
+ | * [[3-OXOACYL-ACP-SYNTH-RXN]] | ||
+ | * [[RXN-10727]] | ||
+ | * [[RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58.]] | ||
+ | * [[RXN-9555]] | ||
+ | * [[RXN-9550]] | ||
+ | * [[RXN-9539]] | ||
+ | * [[RXN-9535]] | ||
+ | * [[RXN-9516]] | ||
+ | * [[RXN-9531]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.3.1.41-RXN]] | ||
+ | * [[RXN-8349_PLANTCYC]] | ||
+ | * [[ACP-S-ACETYLTRANSFER-RXN]] | ||
+ | * [[MALONYL-COA-ACP-TRANSACYL-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a holo-[acyl-carrier protein]}} | |
− | + | {{#set: common name=a holo-ACP|a holo-[acp]}} | |
− | + | {{#set: consumed by=3.1.4.14-RXN|RXN-17155}} | |
− | + | {{#set: produced by=RXN-11474|RXN-17013|RXN-17012|RXN-17015|RXN-16615|RXN-17017|RXN-17016|RXN-17018|RXN-16067|RXN-16025|RXN-16024|1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN|RXN-17014|RXN-14972|RXN3O-1803|RXN-11484|3-OXOACYL-ACP-SYNTH-BASE-RXN|2.3.1.179-RXN|RXN-9523|RXN0-6705|RXN-10654|RXN-10462|RXN-17020|RXN-10658|RXN0-5514|RXN-17024|RXN-9549|RXN-9548|RXN-16629|RXN-9527|RXN-16621|RXN-11479|RXN-16076|RXN-16077|RXN-16625|HOLO-ACP-SYNTH-RXN|RXN0-2141|RXN-17022|3-OXOACYL-ACP-SYNTH-RXN|RXN-10727|RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58.|RXN-9555|RXN-9550|RXN-9539|RXN-9535|RXN-9516|RXN-9531}} | |
− | + | {{#set: reversible reaction associated=2.3.1.41-RXN|RXN-8349_PLANTCYC|ACP-S-ACETYLTRANSFER-RXN|MALONYL-COA-ACP-TRANSACYL-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite ACP
- common name:
- a holo-[acyl-carrier protein]
- Synonym(s):
- a holo-ACP
- a holo-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- RXN-11474
- RXN-17013
- RXN-17012
- RXN-17015
- RXN-16615
- RXN-17017
- RXN-17016
- RXN-17018
- RXN-16067
- RXN-16025
- RXN-16024
- 1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN
- RXN-17014
- RXN-14972
- RXN3O-1803
- RXN-11484
- 3-OXOACYL-ACP-SYNTH-BASE-RXN
- 2.3.1.179-RXN
- RXN-9523
- RXN0-6705
- RXN-10654
- RXN-10462
- RXN-17020
- RXN-10658
- RXN0-5514
- RXN-17024
- RXN-9549
- RXN-9548
- RXN-16629
- RXN-9527
- RXN-16621
- RXN-11479
- RXN-16076
- RXN-16077
- RXN-16625
- HOLO-ACP-SYNTH-RXN
- RXN0-2141
- RXN-17022
- 3-OXOACYL-ACP-SYNTH-RXN
- RXN-10727
- [[RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58.]]
- RXN-9555
- RXN-9550
- RXN-9539
- RXN-9535
- RXN-9516
- RXN-9531
Reaction(s) of unknown directionality
External links
"a holo-[acyl-carrier protein" cannot be used as a page name in this wiki.
"a holo-[acp" cannot be used as a page name in this wiki.
"RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58." cannot be used as a page name in this wiki.