Difference between revisions of "RXN-12473"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12473 RXN-12473] == * direction: ** LEFT-TO-RIGHT * common name: ** molybdopterin-synthase aden...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12473 RXN-12473] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** molybdopterin-synthase adenylyltransferase / sulfurtransferase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.8.1.11 EC-2.8.1.11] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''+''' 1 [[Carboxyadenylated-MPT-synthases]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[Thiocarboxylated-MPT-synthases]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[PROTON]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''+''' 1 a carboxy-adenylated small subunit of molybdopterin synthase[c] '''+''' 1 an reduced unknown electron acceptor[c] '''=>''' 1 a thiocarboxylated small subunit of molybdopterin synthase[c] '''+''' 1 AMP[c] '''+''' 1 an oxidized unknown electron acceptor[c] '''+''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 H+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-22_001380]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823] | ||
| + | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=molybdopterin-synthase adenylyltransferase / sulfurtransferase}} | |
| − | {{#set: | + | {{#set: ec number=EC-2.8.1.11}} |
| − | {{#set: | + | {{#set: gene associated=Ec-22_001380}} |
| − | {{#set: | + | {{#set: in pathway=PWY-6823}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:42, 21 March 2018
Contents
Reaction RXN-12473
- direction:
- LEFT-TO-RIGHT
- common name:
- molybdopterin-synthase adenylyltransferase / sulfurtransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-Cysteine-Desulfurase-persulfide[c] + 1 Carboxyadenylated-MPT-synthases[c] + 1 Donor-H2[c] => 1 Thiocarboxylated-MPT-synthases[c] + 1 AMP[c] + 1 Acceptor[c] + 1 Cysteine-Desulfurase-L-cysteine[c] + 1 PROTON[c]
- With common name(s):
- 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] + 1 a carboxy-adenylated small subunit of molybdopterin synthase[c] + 1 an reduced unknown electron acceptor[c] => 1 a thiocarboxylated small subunit of molybdopterin synthase[c] + 1 AMP[c] + 1 an oxidized unknown electron acceptor[c] + 1 an [L-cysteine desulfurase]-L-cysteine[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-22_001380
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6823, molybdenum cofactor biosynthesis: PWY-6823
- 7 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
