Difference between revisions of "D-GALACTONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M |
* common name: | * common name: | ||
− | ** D- | + | ** D-galactonate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 195.149 |
* Synonym(s): | * Synonym(s): | ||
+ | ** galactonate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GALACTONOLACTONASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461127 5461127] |
+ | * HMDB : HMDB00565 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00880 C00880] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4574468.html 4574468] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12931 12931] |
− | * | + | * BIGG : 36277 |
− | + | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | |
− | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=D-galactonate}} |
− | {{#set: common name=D- | + | {{#set: molecular weight=195.149 }} |
− | {{#set: molecular weight= | + | {{#set: common name=galactonate}} |
− | {{#set: | + | {{#set: produced by=GALACTONOLACTONASE-RXN}} |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite D-GALACTONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M
- common name:
- D-galactonate
- molecular weight:
- 195.149
- Synonym(s):
- galactonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.