Difference between revisions of "CPD-514"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_004220 == * left end position: ** 3514846 * transcription direction: ** POSITIVE * right end position: ** 3518351 * centisome position: ** 40.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-514 CPD-514] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-514 CPD-514] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NHDPIYICCBKNNJ-FUEUKBNZSA-J |
− | * | + | * common name: |
− | ** | + | ** 3-oxo-3-phenylpropanoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 909.648 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** benzoyl-acetyl-CoA |
− | ** | + | ** oxocinnamoyl-CoA |
+ | ** 3-keto-3-phenylpropionyl-CoA | ||
+ | ** β-oxophenyl-propionyl-CoA | ||
+ | ** 3-oxo-3-phenylpropionyl-coenzyme A | ||
+ | ** 3-oxo-3-phenylpropionyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-2006]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07118 C07118] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27388 27388] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC27388 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203310 25203310] | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=NHDPIYICCBKNNJ-FUEUKBNZSA-J}} | ||
+ | {{#set: common name=3-oxo-3-phenylpropanoyl-CoA}} | ||
+ | {{#set: molecular weight=909.648 }} | ||
+ | {{#set: common name=benzoyl-acetyl-CoA|oxocinnamoyl-CoA|3-keto-3-phenylpropionyl-CoA|β-oxophenyl-propionyl-CoA|3-oxo-3-phenylpropionyl-coenzyme A|3-oxo-3-phenylpropionyl-CoA}} | ||
+ | {{#set: consumed by=RXN-2006}} |
Latest revision as of 20:43, 21 March 2018
Contents
Metabolite CPD-514
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=NHDPIYICCBKNNJ-FUEUKBNZSA-J
- common name:
- 3-oxo-3-phenylpropanoyl-CoA
- molecular weight:
- 909.648
- Synonym(s):
- benzoyl-acetyl-CoA
- oxocinnamoyl-CoA
- 3-keto-3-phenylpropionyl-CoA
- β-oxophenyl-propionyl-CoA
- 3-oxo-3-phenylpropionyl-coenzyme A
- 3-oxo-3-phenylpropionyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.