Difference between revisions of "CPD-7682"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_003020 == * left end position: ** 3296289 * transcription direction: ** POSITIVE * right end position: ** 3300091 * centisome position: ** 55.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == * smiles: ** C(C1(CCCC=N1))([O-])=O * inchi key: ** InChIKey=CSDPVAKVEWET...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(CCCC=N1))([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M |
− | * | + | * common name: |
− | ** | + | ** 1-piperideine 6-carboxylate |
− | * | + | * molecular weight: |
− | ** | + | ** 126.135 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Δ1-piperideine-6-carboxylate |
− | ** | + | ** Δ6-piperideine-2-carboxylate |
+ | ** 1,6-didehydropiperidine-2-carboxylate | ||
+ | ** 2,3,4,5-tetrahydropyridine-2-carboxylate | ||
+ | ** (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10855]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-8173]] |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00450 C00450] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58769 58769] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC58769 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266761 45266761] |
+ | * HMDB : HMDB59657 | ||
+ | {{#set: smiles=C(C1(CCCC=N1))([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M}} | ||
+ | {{#set: common name=1-piperideine 6-carboxylate}} | ||
+ | {{#set: molecular weight=126.135 }} | ||
+ | {{#set: common name=Δ1-piperideine-6-carboxylate|Δ6-piperideine-2-carboxylate|1,6-didehydropiperidine-2-carboxylate|2,3,4,5-tetrahydropyridine-2-carboxylate|(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate}} | ||
+ | {{#set: consumed by=RXN-10855}} | ||
+ | {{#set: reversible reaction associated=RXN-8173}} |
Latest revision as of 20:43, 21 March 2018
Contents
Metabolite CPD-7682
- smiles:
- C(C1(CCCC=N1))([O-])=O
- inchi key:
- InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M
- common name:
- 1-piperideine 6-carboxylate
- molecular weight:
- 126.135
- Synonym(s):
- Δ1-piperideine-6-carboxylate
- Δ6-piperideine-2-carboxylate
- 1,6-didehydropiperidine-2-carboxylate
- 2,3,4,5-tetrahydropyridine-2-carboxylate
- (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(CCCC=N1))([O-])=O" cannot be used as a page name in this wiki.