Difference between revisions of "GDP-TP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17017 RXN-17017] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycerol-3-phosphate O-acyl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
| + | * inchi key: | ||
| + | ** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H | ||
* common name: | * common name: | ||
| − | ** | + | ** pppGpp |
| − | * | + | * molecular weight: |
| − | ** | + | ** 677.095 |
* Synonym(s): | * Synonym(s): | ||
| + | ** guanosine pentaphosphate | ||
| + | ** guanosine 3'-diphosphate 5'-triphosphate | ||
| + | ** guanosine 5'-triphosphate,3'-diphosphate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[GTPPYPHOSKIN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494] |
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690] |
| − | {{#set: | + | * BIGG : 43927 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549] |
| − | {{#set: | + | * HMDB : HMDB60480 |
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
| + | {{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}} | ||
| + | {{#set: common name=pppGpp}} | ||
| + | {{#set: molecular weight=677.095 }} | ||
| + | {{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}} | ||
| + | {{#set: produced by=GTPPYPHOSKIN-RXN}} | ||
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite GDP-TP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
- common name:
- pppGpp
- molecular weight:
- 677.095
- Synonym(s):
- guanosine pentaphosphate
- guanosine 3'-diphosphate 5'-triphosphate
- guanosine 5'-triphosphate,3'-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
