Difference between revisions of "CPD-713"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12508 RXN-12508] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-(α-hydroxyethyl)-TP...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12508 RXN-12508] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
 
* common name:
 
* common name:
−
** 2-(α-hydroxyethyl)-TPP:[dihydrolipoyllysine-residue acetyltransferase]-lipoyllysine acetyltransferase
+
** 6-oxocampestanol
−
** Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II
+
* molecular weight:
 +
** 416.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** oxocampestanol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-715]]
−
** 1 [[2-ALPHA-HYDROXYETHYL-THPP]][c] '''+''' 1 [[Pyruvate-dehydrogenase-lipoate]][c] '''=>''' 1 [[THIAMINE-PYROPHOSPHATE]][c] '''+''' 1 [[Pyruvate-dehydrogenase-acetylDHlipoyl]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 2-(α-hydroxyethyl)thiamine diphosphate[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] '''=>''' 1 thiamine diphosphate[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-S-acetyldihydrolipoyl-L-lysine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-23_002710]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-18_003420]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03270 R03270]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200917 25200917]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=2-(α-hydroxyethyl)-TPP:[dihydrolipoyllysine-residue acetyltransferase]-lipoyllysine acetyltransferase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
−
{{#set: common name=Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: gene associated=Ec-23_002710|Ec-18_003420}}
+
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
−
{{#set: in pathway=}}
+
{{#set: common name=6-oxocampestanol}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=416.686    }}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=oxocampestanol}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-715}}

Latest revision as of 19:44, 21 March 2018

Metabolite CPD-713

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
  • common name:
    • 6-oxocampestanol
  • molecular weight:
    • 416.686
  • Synonym(s):
    • oxocampestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-713&oldid=29078"