|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-DIRECTED-RNA-POLYMERASE-RXN DNA-DIRECTED-RNA-POLYMERASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * inchi key: |
| + | ** InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J |
| * common name: | | * common name: |
− | ** DNA-directed RNA polymerase | + | ** trans-Δ2, cis-Δ4-decadienoyl-CoA |
− | ** RNA polymerase II subunit A
| + | * molecular weight: |
− | ** DNA-directed RNA polymerase III, subunit Rpc31
| + | ** 913.722 |
− | * ec number: | + | |
− | ** [http://enzyme.expasy.org/EC/2.7.7.6 EC-2.7.7.6] | + | |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[DIENOYLCOAREDUCT-RXN]] |
− | ** 1 [[RNA-Holder]][c] '''+''' 1 [[Nucleoside-Triphosphates]][c] '''<=>''' 1 [[RNA-Holder]][c] '''+''' 1 [[PPI]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 RNA[c] '''+''' 1 a nucleoside triphosphate[c] '''<=>''' 1 RNA[c] '''+''' 1 diphosphate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * Gene: [[Ec-12_008560]] | + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-14_004750]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-07_003640]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-04_001110]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-00_003160]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-00_002530]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-24_002610]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-12_005950]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | * Gene: [[Ec-15_003650]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-10_004380]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-14_001310]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-16_000770]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-25_003070]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-03_002970]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-21_000330]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-12_006450]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-10_004770]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-08_001270]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-12_005690]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-11_006010]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-24_001300]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-01_005040]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-01_006640]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-04_006380]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | * Gene: [[Ec-06_000280]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-06_003770]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-00_002160]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | * Gene: [[Ec-12_005940]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | * Gene: [[Ec-05_004090]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Assignment: GO-TERM
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P08518 P08518] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658212 90658212] |
− | ** [http://www.uniprot.org/uniprot/P07703 P07703]
| + | {{#set: smiles=CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://www.uniprot.org/uniprot/P11414 P11414]
| + | {{#set: inchi key=InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P08266 P08266]
| + | {{#set: common name=trans-Δ2, cis-Δ4-decadienoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P08775 P08775]
| + | {{#set: molecular weight=913.722 }} |
− | ** [http://www.uniprot.org/uniprot/P11704 P11704]
| + | {{#set: consumed by=DIENOYLCOAREDUCT-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q26794 Q26794]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26791 Q26791]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17546 P17546]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20433 P20433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19388 P19388]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14563 P14563]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9HM79 Q9HM79]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16356 P16356]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26793 Q26793]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20434 P20434]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19387 P19387]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28000 P28000]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22138 P22138]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A7Z7 P0A7Z7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22703 P22703]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38421 P38421]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32910 P32910]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32529 P32529]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A4E5 P0A4E5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P61217 P61217]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35084 P35084]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57648 Q57648]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46449 Q46449]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9V115 Q9V115]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PM80 Q9PM80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46124 Q46124]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11705 P11705]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17545 P17545]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14564 P14564]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11512 P11512]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22704 P22704]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43737 P43737]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58446 Q58446]
| + | |
− | ** [http://www.uniprot.org/uniprot/O96236 O96236]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PI30 Q9PI30]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06505 P06505]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11703 P11703]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20436 P20436]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22705 P22705]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57832 Q57832]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51349 O51349]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PN25 Q9PN25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JX03 Q9JX03]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33058 P33058]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47268 P47268]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57839 Q57839]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27123 O27123]
| + | |
− | ** [http://www.uniprot.org/uniprot/P57009 P57009]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20429 P20429]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57840 Q57840]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58785 Q58785]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33054 P33054]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33812 P33812]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29398 P29398]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47423 P47423]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47582 P47582]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57650 Q57650]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58443 Q58443]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27124 O27124]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37870 P37870]
| + | |
− | ** [http://www.uniprot.org/uniprot/P66724 P66724]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43739 P43739]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43740 P43740]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47583 P47583]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58444 Q58444]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27125 O27125]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67763 O67763]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84316 O84316]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9HWC9 Q9HWC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33053 P33053]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43738 P43738]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60181 Q60181]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27126 O27126]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84317 O84317]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UYX7 Q9UYX7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P66704 P66704]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42483 Q42483]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39477 Q39477]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18616 P18616]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R5E7 Q9R5E7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19175 P19175]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19176 P19176]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20028 P20028]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15398 P15398]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12464 P12464]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06356 Q06356]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06357 Q06357]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06358 Q06358]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q25655 Q25655]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00573 P00573]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18147 P18147]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07659 P07659]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27999 P27999]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04050 P04050]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17890 P17890]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04051 P04051]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20435 P20435]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06173 P06173]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A7Z4 P0A7Z4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A8V2 P0A8V2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A8T7 P0A8T7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A800 P0A800]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23579 P23579]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23580 P23580]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23581 P23581]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04052 P04052]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25167 P25167]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06270 P06270]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06272 P06272]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06273 P06273]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06274 P06274]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06269 P06269]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06271 P06271]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12090 P12090]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12091 P12091]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12092 P12092]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12093 P12093]
| + | |
− | ** [http://www.uniprot.org/uniprot/P68611 P68611]
| + | |
− | ** [http://www.uniprot.org/uniprot/P68610 P68610]
| + | |
− | ** [http://www.uniprot.org/uniprot/P68609 P68609]
| + | |
− | ** [http://www.uniprot.org/uniprot/P68608 P68608]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21603 P21603]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24757 P24757]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07392 P07392]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q76ZP7 Q76ZP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P68694 P68694]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21087 P21087]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16716 P16716]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17474 P17474]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12073 P12073]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09562 P09562]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16023 P16023]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16024 P16024]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16025 P16025]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14248 P14248]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21421 P21421]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08036 P08036]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08968 P08968]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09844 P09844]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09845 P09845]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09846 P09846]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09847 P09847]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15352 P15352]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15351 P15351]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15349 P15349]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15353 P15353]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15354 P15354]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q23692 Q23692]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13911 P13911]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11513 P11513]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11514 P11514]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12227 P12227]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06221 P06221]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21422 P21422]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99366 Q99366]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99367 Q99367]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99368 Q99368]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31815 P31815]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42075 P42075]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42076 P42076]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42078 P42078]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24928 P24928]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27059 P27059]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41559 P41559]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31814 P31814]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31813 P31813]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29158 P29158]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03588 Q03588]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03587 Q03587]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03585 Q03585]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03586 Q03586]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36594 P36594]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8HTL6 Q8HTL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8HTL7 Q8HTL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01569 Q01569]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33540 P33540]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33539 P33539]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30876 P30876]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34087 P34087]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01923 Q01923]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30760 P30760]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30761 P30761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q83656 Q83656]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41184 P41184]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41185 P41185]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28363 P28363]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28364 P28364]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02061 Q02061]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35718 P35718]
| + | |
− | ** [http://www.uniprot.org/uniprot/P61218 P61218]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39466 P39466]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36958 P36958]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q33533 Q33533]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36252 P36252]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36954 P36954]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36440 P36440]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36441 P36441]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39471 P39471]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39472 P39472]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41558 P41558]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41557 P41557]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41556 P41556]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14247 P14247]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39463 P39463]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46818 P46818]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22139 P22139]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16370 P16370]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50546 P50546]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13433 P13433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50106 P50106]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32349 P32349]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40422 P40422]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38902 P38902]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47768 P47768]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47770 P47770]
| + | |
− | ** [http://www.uniprot.org/uniprot/O03685 O03685]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q50295 Q50295]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01080 Q01080]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42877 Q42877]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40293 Q40293]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q25543 Q25543]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40295 Q40295]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q11199 Q11199]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41524 Q41524]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22276 P22276]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10964 P10964]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25441 P25441]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28365 P28365]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27826 Q27826]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39211 Q39211]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39212 Q39212]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q31854 Q31854]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q38859 Q38859]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52435 P52435]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q25802 Q25802]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27900 Q27900]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51250 P51250]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51251 P51251]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51252 P51252]
| + | |
− | ** [http://www.uniprot.org/uniprot/P95989 P95989]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74177 P74177]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73297 P73297]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73334 P73334]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77965 P77965]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q48975 Q48975]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q48981 Q48981]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49003 Q49003]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49077 Q49077]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46217 P46217]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42486 P42486]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42487 P42487]
| + | |
− | ** [http://www.uniprot.org/uniprot/O21237 O21237]
| + | |
− | ** [http://www.uniprot.org/uniprot/O21238 O21238]
| + | |
− | ** [http://www.uniprot.org/uniprot/O21260 O21260]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49465 P49465]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49466 P49466]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49467 P49467]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49468 P49468]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82725 O82725]
| + | |
− | ** [http://www.uniprot.org/uniprot/O55766 O55766]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43553 Q43553]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24216 O24216]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38420 P38420]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23999 O23999]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48120 P48120]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42080 P42080]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48119 P48119]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48118 P48118]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56299 P56299]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56300 P56300]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12465 P12465]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56298 P56298]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41606 P41606]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52733 P52733]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41607 P41607]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41629 P41629]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39290 Q39290]
| + | |
− | ** [http://www.uniprot.org/uniprot/P91875 P91875]
| + | |
− | ** [http://www.uniprot.org/uniprot/O35134 O35134]
| + | |
− | ** [http://www.uniprot.org/uniprot/O54889 O54889]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38671 P38671]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YW50 Q9YW50]
| + | |
− | ** [http://www.uniprot.org/uniprot/O21375 O21375]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q85373 Q85373]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33811 P33811]
| + | |
− | ** [http://www.uniprot.org/uniprot/O74633 O74633]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q85288 Q85288]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98246 Q98246]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98264 Q98264]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98839 Q98839]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98301 Q98301]
| + | |
− | ** [http://www.uniprot.org/uniprot/O57187 O57187]
| + | |
− | ** [http://www.uniprot.org/uniprot/O96446 O96446]
| + | |
− | ** [http://www.uniprot.org/uniprot/O96452 O96452]
| + | |
− | ** [http://www.uniprot.org/uniprot/O77165 O77165]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13896 O13896]
| + | |
− | ** [http://www.uniprot.org/uniprot/O14086 O14086]
| + | |
− | ** [http://www.uniprot.org/uniprot/P87123 P87123]
| + | |
− | ** [http://www.uniprot.org/uniprot/O14459 O14459]
| + | |
− | ** [http://www.uniprot.org/uniprot/O94616 O94616]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36595 P36595]
| + | |
− | ** [http://www.uniprot.org/uniprot/O54888 O54888]
| + | |
− | ** [http://www.uniprot.org/uniprot/P70700 P70700]
| + | |
− | ** [http://www.uniprot.org/uniprot/O09451 O09451]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47767 P47767]
| + | |
− | ** [http://www.uniprot.org/uniprot/O74635 O74635]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09177 Q09177]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92399 Q92399]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13877 O13877]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48011 P48011]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10578 Q10578]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48909 O48909]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48910 O48910]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48911 O48911]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48913 O48913]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48914 O48914]
| + | |
− | ** [http://www.uniprot.org/uniprot/O50634 O50634]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81098 O81098]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81097 O81097]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19749 P19749]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=DNA-directed RNA polymerase}} | + | |
− | {{#set: common name=RNA polymerase II subunit A}} | + | |
− | {{#set: common name=DNA-directed RNA polymerase III, subunit Rpc31}}
| + | |
− | {{#set: ec number=EC-2.7.7.6}}
| + | |
− | {{#set: gene associated=Ec-12_008560|Ec-14_004750|Ec-07_003640|Ec-04_001110|Ec-00_003160|Ec-00_002530|Ec-24_002610|Ec-12_005950|Ec-15_003650|Ec-10_004380|Ec-14_001310|Ec-16_000770|Ec-25_003070|Ec-03_002970|Ec-21_000330|Ec-12_006450|Ec-10_004770|Ec-08_001270|Ec-12_005690|Ec-11_006010|Ec-24_001300|Ec-01_005040|Ec-01_006640|Ec-04_006380|Ec-06_000280|Ec-06_003770|Ec-00_002160|Ec-12_005940|Ec-05_004090}}
| + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |