Difference between revisions of "DIHYDROSIROHYDROCHLORIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] == * smiles: ** CCCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=GHVNFZFCNZKVNT-U...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROSIROHYDROCHLORIN DIHYDROSIROHYDROCHLORIN] == * smiles: ** CC5(CC(=O)[O-])(C(C4(=CC1(NC(=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROSIROHYDROCHLORIN DIHYDROSIROHYDROCHLORIN] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-]) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G |
* common name: | * common name: | ||
| − | ** | + | ** precorrin-2 |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 857.803 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dihydrosirohydrochlorin |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13403]] | ||
| + | * [[RXN-8675]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-8759]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 82542-92-5 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245987 25245987] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58827 58827] |
| − | * | + | * BIGG : 39875 |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02463 C02463] |
| − | {{#set: common name= | + | {{#set: smiles=CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G}} |
| − | {{#set: common name= | + | {{#set: common name=precorrin-2}} |
| − | {{#set: | + | {{#set: molecular weight=857.803 }} |
| + | {{#set: common name=dihydrosirohydrochlorin}} | ||
| + | {{#set: produced by=RXN-13403|RXN-8675}} | ||
| + | {{#set: reversible reaction associated=RXN-8759}} | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite DIHYDROSIROHYDROCHLORIN
- smiles:
- CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])
- inchi key:
- InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G
- common name:
- precorrin-2
- molecular weight:
- 857.803
- Synonym(s):
- dihydrosirohydrochlorin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])" cannot be used as a page name in this wiki.
