Difference between revisions of "RXN-8040"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17388 CPD-17388] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8040 RXN-8040] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.5.1...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17388 CPD-17388] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8040 RXN-8040] ==
* smiles:
+
* direction:
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=DNHDPAXPQGYGIJ-KWFBMMABSA-J
+
** [http://enzyme.expasy.org/EC/5.5.1 EC-5.5.1]
* common name:
+
** 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
+
* molecular weight:
+
** 1116.018   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-16137]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NEUROSPORENE]][c] '''<=>''' 1 [[CPD-7422]][c]
* [[RXN-16136]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 all-trans neurosporene[c] '''<=>''' 1 &alpha;-zeacarotene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-07_007260]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-24_002140]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-00_005820]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-00_005850]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-10_006240]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-02_005510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-24_002150]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581251 71581251]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06960 R06960]
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74304 74304]
+
{{#set: ec number=EC-5.5.1}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: gene associated=Ec-07_007260|Ec-24_002140|Ec-00_005820|Ec-00_005850|Ec-10_006240|Ec-02_005510|Ec-24_002150}}
{{#set: inchi key=InChIKey=DNHDPAXPQGYGIJ-KWFBMMABSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=1116.018    }}
+
{{#set: reconstruction source=orthology-aragem}}
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: consumed by=RXN-16137}}
+
{{#set: produced by=RXN-16136}}
+

Latest revision as of 19:46, 21 March 2018

Reaction RXN-8040

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 all-trans neurosporene[c] <=> 1 α-zeacarotene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links