Difference between revisions of "RXN66-281"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-281 RXN66-281] == * direction: ** LEFT-TO-RIGHT * common name: ** squalene synthase ** Isopen...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-281 RXN66-281] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** squalene synthase |
| − | + | ** Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CPD-465]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[SQUALENE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[PPI]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 NAD(P)H[c] '''+''' 1 presqualene diphosphate[c] '''+''' 1 H+[c] '''=>''' 1 squalene[c] '''+''' 1 NAD(P)+[c] '''+''' 1 diphosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-11_001030]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02872 R02872] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=squalene synthase}} | |
| − | * LIGAND- | + | {{#set: common name=Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-11_001030}} |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:47, 21 March 2018
Contents
Reaction RXN66-281
- direction:
- LEFT-TO-RIGHT
- common name:
- squalene synthase
- Isopentenyl-diphosphate delta-isomerase type 1 fused to squalene synthase; probably two separate ORFs
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADH-P-OR-NOP[c] + 1 CPD-465[c] + 1 PROTON[c] => 1 SQUALENE[c] + 1 NAD-P-OR-NOP[c] + 1 PPI[c]
- With common name(s):
- 1 NAD(P)H[c] + 1 presqualene diphosphate[c] + 1 H+[c] => 1 squalene[c] + 1 NAD(P)+[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-11_001030
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
